C22H36O5Si — CID 140847785
methyl (4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,8a-dimethyl-4-oxo-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-4aH-chromene-3-carboxylate (PubChem CID 140847785) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is methyl (4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,8a-dimethyl-4-oxo-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-4aH-chromene-3-carboxylate.
| Compound Name | methyl (4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,8a-dimethyl-4-oxo-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-4aH-chromene-3-carboxylate |
|---|---|
| PubChem CID | 140847785 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | methyl (4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,8a-dimethyl-4-oxo-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-4aH-chromene-3-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)OC(C)=C(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C22H36O5Si/c1-13(2)15-11-16-19(23)18(20(24)25-8)14(3)26-22(16,7)17(12-15)27-28(9,10)21(4,5)6/h15-17H,1,11-12H2,2-10H3/t15-,16-,17-,22-/m0/s1 |
| InChIKey | GUGWPSNSWQKMHD-DOWNOZBLSA-N |
| XLogP | 4.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|