C20H38O5Si — CID 23584626
(1R,5S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-2-oxabicyclo[3.3.1]nonan-3-one (PubChem CID 23584626) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is (1R,5S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-2-oxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1R,5S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-2-oxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 23584626 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (1R,5S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-1,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-2-oxabicyclo[3.3.1]nonan-3-one |
| SMILES | CC(C)(C)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)OC(=O)C[C@@]1(C)[C@@H]2O |
| InChI | InChI=1S/C20H38O5Si/c1-17(2,3)23-13-11-14(25-26(9,10)18(4,5)6)20(8)16(22)19(13,7)12-15(21)24-20/h13-14,16,22H,11-12H2,1-10H3/t13-,14-,16-,19+,20-/m0/s1 |
| InChIKey | GDWILPKPEWLLPP-PQWXKCTQSA-N |
| XLogP | 4.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|