C23H37NO2Si — CID 10318051
(1R,4aS,4bR,8aR,9R,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-7-oxo-4,4b,5,6,8,9,10,10a-octahydro-1H-phenanthrene-8a-carbonitrile (PubChem CID 10318051) has the molecular formula C23H37NO2Si and a molecular weight of 387.64 g/mol. Its IUPAC name is (1R,4aS,4bR,8aR,9R,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-7-oxo-4,4b,5,6,8,9,10,10a-octahydro-1H-phenanthrene-8a-carbonitrile.
| Compound Name | (1R,4aS,4bR,8aR,9R,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-7-oxo-4,4b,5,6,8,9,10,10a-octahydro-1H-phenanthrene-8a-carbonitrile |
|---|---|
| PubChem CID | 10318051 |
| Molecular Formula | C23H37NO2Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | (1R,4aS,4bR,8aR,9R,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-1,4a-dimethyl-7-oxo-4,4b,5,6,8,9,10,10a-octahydro-1H-phenanthrene-8a-carbonitrile |
| SMILES | C[C@@H]1C=CC[C@]2(C)[C@H]3CCC(=O)C[C@@]3(C#N)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C23H37NO2Si/c1-16-9-8-12-22(5)18(16)13-20(26-27(6,7)21(2,3)4)23(15-24)14-17(25)10-11-19(22)23/h8-9,16,18-20H,10-14H2,1-7H3/t16-,18+,19-,20-,22+,23+/m1/s1 |
| InChIKey | JCFFCIVSOLEBIW-HHULTKIHSA-N |
| XLogP | 5.88 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|