C24H40O5Si — CID 10812852
(1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione (PubChem CID 10812852) has the molecular formula C24H40O5Si and a molecular weight of 436.67 g/mol. Its IUPAC name is (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione.
| Compound Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
|---|---|
| PubChem CID | 10812852 |
| Molecular Formula | C24H40O5Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
| SMILES | C[C@@H]1CC(=O)[C@H](O)[C@@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)[C@@]3(C)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H40O5Si/c1-13-10-15(25)19(26)22(5)14(13)11-17(29-30(8,9)21(2,3)4)23(6)16(22)12-18-24(7,28-18)20(23)27/h13-14,16-19,26H,10-12H2,1-9H3/t13-,14+,16-,17-,18+,19+,22+,23+,24+/m1/s1 |
| InChIKey | YAJYQMVVVUATPC-CRXPPILXSA-N |
| XLogP | 4.13 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|