C31H46O5Si — CID 10554129
(1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione (PubChem CID 10554129) has the molecular formula C31H46O5Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione.
| Compound Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
|---|---|
| PubChem CID | 10554129 |
| Molecular Formula | C31H46O5Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (1R,2S,3R,6R,7S,9R,10S,12S,14S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,10,12-tetramethyl-3-phenylmethoxy-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-4,11-dione |
| SMILES | C[C@@H]1CC(=O)[C@H](OCc2ccccc2)[C@@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)[C@@]3(C)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H46O5Si/c1-19-15-22(32)26(34-18-20-13-11-10-12-14-20)29(5)21(19)16-24(36-37(8,9)28(2,3)4)30(6)23(29)17-25-31(7,35-25)27(30)33/h10-14,19,21,23-26H,15-18H2,1-9H3/t19-,21+,23-,24-,25+,26+,29+,30+,31+/m1/s1 |
| InChIKey | OYLDDLFQKXGSOD-LKYWOXLGSA-N |
| XLogP | 6.35 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|