C18H26O3Si — CID 99772660
(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxycyclopent-2-en-1-one (PubChem CID 99772660) has the molecular formula C18H26O3Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxycyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 99772660 |
| Molecular Formula | C18H26O3Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxycyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=CC(=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H26O3Si/c1-18(2,3)22(4,5)21-16-12-11-15(19)17(16)20-13-14-9-7-6-8-10-14/h6-12,16-17H,13H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | JYIDTNICXMISMB-IRXDYDNUSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|