C26H44O6Si2 — CID 10052008
benzyl (1S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-oxocyclohexane-1-carboxylate (PubChem CID 10052008) has the molecular formula C26H44O6Si2 and a molecular weight of 508.80 g/mol. Its IUPAC name is benzyl (1S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-oxocyclohexane-1-carboxylate.
| Compound Name | benzyl (1S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10052008 |
| Molecular Formula | C26H44O6Si2 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | benzyl (1S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-5-oxocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)C[C@](O)(C(=O)OCc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O6Si2/c1-24(2,3)33(7,8)31-21-17-26(29,23(28)30-18-19-14-12-11-13-15-19)16-20(27)22(21)32-34(9,10)25(4,5)6/h11-15,21-22,29H,16-18H2,1-10H3/t21-,22-,26-/m1/s1 |
| InChIKey | LHPIXQIQSTVVFV-XLGIIRLISA-N |
| XLogP | 5.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|