C32H43NO6SSi — CID 15468851
benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 15468851) has the molecular formula C32H43NO6SSi and a molecular weight of 597.85 g/mol. Its IUPAC name is benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15468851 |
| Molecular Formula | C32H43NO6SSi |
| Molecular Weight | 597.85 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | benzyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethyl-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | CC1=C(C)C[C@@]2(C(=O)OCc3ccccc3)C(=O)N(S(=O)(=O)c3ccc(C)cc3)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C32H43NO6SSi/c1-22-14-16-26(17-15-22)40(36,37)33-20-28(39-41(7,8)31(4,5)6)27-18-23(2)24(3)19-32(27,29(33)34)30(35)38-21-25-12-10-9-11-13-25/h9-17,27-28H,18-21H2,1-8H3/t27-,28-,32+/m1/s1 |
| InChIKey | VPYVMBZWMYWCNK-AUSNRZEJSA-N |
| XLogP | 6.39 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|