C28H39NO4SSi — CID 135066684
(5S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one (PubChem CID 135066684) has the molecular formula C28H39NO4SSi and a molecular weight of 513.78 g/mol. Its IUPAC name is (5S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one.
| Compound Name | (5S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 135066684 |
| Molecular Formula | C28H39NO4SSi |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (5S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-methylphenyl)sulfonyl-9-phenyl-6-azaspiro[4.5]decan-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](c3ccccc3)C[C@]23CCCC3=O)cc1 |
| InChI | InChI=1S/C28H39NO4SSi/c1-21-14-16-23(17-15-21)34(31,32)29-20-25(33-35(5,6)27(2,3)4)24(22-11-8-7-9-12-22)19-28(29)18-10-13-26(28)30/h7-9,11-12,14-17,24-25H,10,13,18-20H2,1-6H3/t24-,25+,28-/m0/s1 |
| InChIKey | OTUXTUPDOGOJOV-OARDWFSCSA-N |
| XLogP | 6.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|