C31H41NO8SSi — CID 15468839
benzyl (4S,4aR,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate (PubChem CID 15468839) has the molecular formula C31H41NO8SSi and a molecular weight of 615.82 g/mol. Its IUPAC name is benzyl (4S,4aR,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate.
| Compound Name | benzyl (4S,4aR,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 15468839 |
| Molecular Formula | C31H41NO8SSi |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | benzyl (4S,4aR,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1,6-dioxo-3,4,4a,5,7,8-hexahydroisoquinoline-8a-carboxylate |
| SMILES | COC1CC(=O)C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CN(S(=O)(=O)c3ccc(C)cc3)C(=O)[C@@]12C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H41NO8SSi/c1-21-13-15-24(16-14-21)41(36,37)32-19-26(40-42(6,7)30(2,3)4)25-17-23(33)18-27(38-5)31(25,28(32)34)29(35)39-20-22-11-9-8-10-12-22/h8-16,25-27H,17-20H2,1-7H3/t25-,26+,27?,31-/m0/s1 |
| InChIKey | XZSWSLUVINODMQ-NKFYVHBOSA-N |
| XLogP | 4.64 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|