C31H41NO7SSi — CID 101062769
benzyl (4S,4aS,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 101062769) has the molecular formula C31H41NO7SSi and a molecular weight of 599.82 g/mol. Its IUPAC name is benzyl (4S,4aS,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | benzyl (4S,4aS,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 101062769 |
| Molecular Formula | C31H41NO7SSi |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | benzyl (4S,4aS,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2-(4-methylphenyl)sulfonyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | COC1C=CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CN(S(=O)(=O)c3ccc(C)cc3)C(=O)[C@]12C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H41NO7SSi/c1-22-16-18-24(19-17-22)40(35,36)32-20-26(39-41(6,7)30(2,3)4)25-14-11-15-27(37-5)31(25,28(32)33)29(34)38-21-23-12-9-8-10-13-23/h8-13,15-19,25-27H,14,20-21H2,1-7H3/t25-,26-,27?,31-/m1/s1 |
| InChIKey | JTKUIBNSYHMBMB-ANBBKAPTSA-N |
| XLogP | 5.24 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|