C24H25NO6S — CID 15309467
benzyl (3R,4S)-1-(4-methylphenyl)sulfonyl-2-oxo-4-[(E)-4-oxobut-2-enyl]piperidine-3-carboxylate (PubChem CID 15309467) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is benzyl (3R,4S)-1-(4-methylphenyl)sulfonyl-2-oxo-4-[(E)-4-oxobut-2-enyl]piperidine-3-carboxylate.
| Compound Name | benzyl (3R,4S)-1-(4-methylphenyl)sulfonyl-2-oxo-4-[(E)-4-oxobut-2-enyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 15309467 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | benzyl (3R,4S)-1-(4-methylphenyl)sulfonyl-2-oxo-4-[(E)-4-oxobut-2-enyl]piperidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](C/C=C/C=O)[C@@H](C(=O)OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25NO6S/c1-18-10-12-21(13-11-18)32(29,30)25-15-14-20(9-5-6-16-26)22(23(25)27)24(28)31-17-19-7-3-2-4-8-19/h2-8,10-13,16,20,22H,9,14-15,17H2,1H3/b6-5+/t20-,22+/m0/s1 |
| InChIKey | BJMMDJBSICTWBP-KJXQILNXSA-N |
| XLogP | 3.04 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|