C19H30OSi — CID 12061237
tert-butyl-dimethyl-[[(1S,2R,4S,5R)-5-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]silane (PubChem CID 12061237) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2R,4S,5R)-5-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2R,4S,5R)-5-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]silane |
|---|---|
| PubChem CID | 12061237 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2R,4S,5R)-5-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2C[C@H]1C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H30OSi/c1-19(2,3)21(4,5)20-18-13-15-11-16(18)12-17(15)14-9-7-6-8-10-14/h6-10,15-18H,11-13H2,1-5H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | CFEOGSHLELKMTN-XLAORIBOSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|