C35H58O4Si2 — CID 57045340
(2-phenylcyclohexyl) 2-[(3aS,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate (PubChem CID 57045340) has the molecular formula C35H58O4Si2 and a molecular weight of 599.02 g/mol. Its IUPAC name is (2-phenylcyclohexyl) 2-[(3aS,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate.
| Compound Name | (2-phenylcyclohexyl) 2-[(3aS,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate |
|---|---|
| PubChem CID | 57045340 |
| Molecular Formula | C35H58O4Si2 |
| Molecular Weight | 599.02 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | (2-phenylcyclohexyl) 2-[(3aS,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H]2CC(=CC(=O)OC3CCCCC3c3ccccc3)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H58O4Si2/c1-34(2,3)40(7,8)37-24-30-29-21-25(20-27(29)23-32(30)39-41(9,10)35(4,5)6)22-33(36)38-31-19-15-14-18-28(31)26-16-12-11-13-17-26/h11-13,16-17,22,27-32H,14-15,18-21,23-24H2,1-10H3/t27-,28?,29-,30-,31?,32+/m0/s1 |
| InChIKey | YJNLVSPKRJVJLJ-SEKKICPYSA-N |
| XLogP | 9.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.02 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|