C23H42O5Si — CID 11037335
tert-butyl 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate (PubChem CID 11037335) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is tert-butyl 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate.
| Compound Name | tert-butyl 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate |
|---|---|
| PubChem CID | 11037335 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | tert-butyl 2-[(2E)-2-[(3aS,4S,5R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COC/C=C1\C[C@H]2C[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C23H42O5Si/c1-22(2,3)28-21(25)15-26-10-9-16-11-17-13-20(24)19(18(17)12-16)14-27-29(7,8)23(4,5)6/h9,17-20,24H,10-15H2,1-8H3/b16-9+/t17-,18-,19+,20+/m0/s1 |
| InChIKey | QNFHDIZFOTVZOV-UPKHZVLJSA-N |
| XLogP | 4.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|