C33H48O4 — CID 10696993
[(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2Z)-2-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate (PubChem CID 10696993) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2Z)-2-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate.
| Compound Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2Z)-2-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate |
|---|---|
| PubChem CID | 10696993 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [(1S,2R)-2-(2-phenylpropan-2-yl)cyclohexyl] (2Z)-2-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]acetate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C/C(=C\C(=O)O[C@H]3CCCC[C@@H]3C(C)(C)c3ccccc3)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C33H48O4/c1-4-5-7-14-26(34)17-18-27-28-20-23(19-24(28)22-30(27)35)21-32(36)37-31-16-11-10-15-29(31)33(2,3)25-12-8-6-9-13-25/h6,8-9,12-13,17-18,21,24,26-31,34-35H,4-5,7,10-11,14-16,19-20,22H2,1-3H3/b18-17+,23-21-/t24-,26-,27+,28-,29-,30+,31-/m0/s1 |
| InChIKey | OSLQFQUWZJACMK-FDOJYADFSA-N |
| XLogP | 6.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|