C24H34O5 — CID 123978161
1-[[(1R,2R,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-3-hydroxypropan-2-one (PubChem CID 123978161) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is 1-[[(1R,2R,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-3-hydroxypropan-2-one.
| Compound Name | 1-[[(1R,2R,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 123978161 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-[[(1R,2R,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-3-hydroxypropan-2-one |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC2Cc3c(cccc3OCC(=O)CO)C[C@@H]21 |
| InChI | InChI=1S/C24H34O5/c1-2-3-4-7-18(26)9-10-20-21-11-16-6-5-8-24(29-15-19(27)14-25)22(16)12-17(21)13-23(20)28/h5-6,8-10,17-18,20-21,23,25-26,28H,2-4,7,11-15H2,1H3/t17?,18-,20+,21-,23+/m0/s1 |
| InChIKey | SHHVKPXEURAPOC-QQCYWEINSA-N |
| XLogP | 2.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|