C23H31NO3 — CID 71268546
2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-hydroxyoct-1-enyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetonitrile (PubChem CID 71268546) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-hydroxyoct-1-enyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetonitrile.
| Compound Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-hydroxyoct-1-enyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 71268546 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-(3-hydroxyoct-1-enyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetonitrile |
| SMILES | CCCCCC(O)C=C[C@@H]1[C@H]2Cc3cccc(OCC#N)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H31NO3/c1-2-3-4-7-18(25)9-10-19-20-13-16-6-5-8-23(27-12-11-24)21(16)14-17(20)15-22(19)26/h5-6,8-10,17-20,22,25-26H,2-4,7,12-15H2,1H3/t17-,18?,19+,20-,22+/m0/s1 |
| InChIKey | SYRVVWCHDSBOJB-MGAFGEKLSA-N |
| XLogP | 3.80 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|