C24H37O3P3 — CID 153117585
[(1R,2R,3aR,9aS)-1-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-2-methyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl] acetate (PubChem CID 153117585) has the molecular formula C24H37O3P3 and a molecular weight of 466.48 g/mol. Its IUPAC name is [(1R,2R,3aR,9aS)-1-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-2-methyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl] acetate.
| Compound Name | [(1R,2R,3aR,9aS)-1-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-2-methyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl] acetate |
|---|---|
| PubChem CID | 153117585 |
| Molecular Formula | C24H37O3P3 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(1R,2R,3aR,9aS)-1-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-2-methyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl] acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2Cc3cccc(OC(C)=O)c3C[C@H]2C[C@H]1C)OP(P)P |
| InChI | InChI=1S/C24H37O3P3/c1-4-5-6-9-20(27-30(28)29)11-12-21-16(2)13-19-15-23-18(14-22(19)21)8-7-10-24(23)26-17(3)25/h7-8,10-12,16,19-22H,4-6,9,13-15,28-29H2,1-3H3/b12-11+/t16-,19-,20+,21+,22+/m1/s1 |
| InChIKey | VUEYTGDACADHJS-FDZXOFLGSA-N |
| XLogP | 7.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|