C22H35O2P3 — CID 71277383
(2R,3R,4R)-3-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-4-methyl-2-[(3-methylphenyl)methyl]cyclopentan-1-one (PubChem CID 71277383) has the molecular formula C22H35O2P3 and a molecular weight of 424.44 g/mol. Its IUPAC name is (2R,3R,4R)-3-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-4-methyl-2-[(3-methylphenyl)methyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-4-methyl-2-[(3-methylphenyl)methyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 71277383 |
| Molecular Formula | C22H35O2P3 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2R,3R,4R)-3-[(E,3S)-3-bis(phosphanyl)phosphanyloxyoct-1-enyl]-4-methyl-2-[(3-methylphenyl)methyl]cyclopentan-1-one |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1Cc1cccc(C)c1)OP(P)P |
| InChI | InChI=1S/C22H35O2P3/c1-4-5-6-10-19(24-27(25)26)11-12-20-17(3)14-22(23)21(20)15-18-9-7-8-16(2)13-18/h7-9,11-13,17,19-21H,4-6,10,14-15,25-26H2,1-3H3/b12-11+/t17-,19+,20+,21-/m1/s1 |
| InChIKey | MAFCFGYTOJCLGK-OFQPYYHQSA-N |
| XLogP | 6.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|