C23H43O5P — CID 90952630
ethyl-[6-[(1R,2R,3R)-3-methoxy-2-[(3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hexyl]phosphinic acid (PubChem CID 90952630) has the molecular formula C23H43O5P and a molecular weight of 430.57 g/mol. Its IUPAC name is ethyl-[6-[(1R,2R,3R)-3-methoxy-2-[(3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hexyl]phosphinic acid.
| Compound Name | ethyl-[6-[(1R,2R,3R)-3-methoxy-2-[(3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hexyl]phosphinic acid |
|---|---|
| PubChem CID | 90952630 |
| Molecular Formula | C23H43O5P |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | ethyl-[6-[(1R,2R,3R)-3-methoxy-2-[(3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hexyl]phosphinic acid |
| SMILES | CCCCC[C@@H](C=C[C@H]1[C@H](OC)CC(=O)[C@@H]1CCCCCCP(=O)(O)CC)OC |
| InChI | InChI=1S/C23H43O5P/c1-5-7-10-13-19(27-3)15-16-21-20(22(24)18-23(21)28-4)14-11-8-9-12-17-29(25,26)6-2/h15-16,19-21,23H,5-14,17-18H2,1-4H3,(H,25,26)/t19-,20+,21+,23+/m0/s1 |
| InChIKey | MABWGYGRWMEGTQ-ZZLPTCMGSA-N |
| XLogP | 5.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|