C33H64O5Si2 — CID 142487381
methyl 7-[(1R,2R,3R)-5-oxo-3-triethylsilyloxy-2-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate (PubChem CID 142487381) has the molecular formula C33H64O5Si2 and a molecular weight of 597.04 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-5-oxo-3-triethylsilyloxy-2-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-5-oxo-3-triethylsilyloxy-2-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 142487381 |
| Molecular Formula | C33H64O5Si2 |
| Molecular Weight | 597.04 g/mol |
| Exact Mass | 596.43 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-5-oxo-3-triethylsilyloxy-2-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O[Si](CC)(CC)CC)CC(=O)[C@@H]1CCCCCCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H64O5Si2/c1-9-16-19-22-28(37-39(10-2,11-3)12-4)25-26-30-29(23-20-17-18-21-24-33(35)36-8)31(34)27-32(30)38-40(13-5,14-6)15-7/h25-26,28-30,32H,9-24,27H2,1-8H3/b26-25+/t28-,29+,30+,32+/m0/s1 |
| InChIKey | MXMLPQCTIRYPCZ-VDGPNCTHSA-N |
| XLogP | 9.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.04 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|