C26H50O3Si2 — CID 142487363
trans-(3S,4R)-2-methylidene-4-triethylsilyloxy-3-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentan-1-one (PubChem CID 142487363) has the molecular formula C26H50O3Si2 and a molecular weight of 466.86 g/mol. Its IUPAC name is trans-(3S,4R)-2-methylidene-4-triethylsilyloxy-3-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(3S,4R)-2-methylidene-4-triethylsilyloxy-3-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 142487363 |
| Molecular Formula | C26H50O3Si2 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | trans-(3S,4R)-2-methylidene-4-triethylsilyloxy-3-[(E,3S)-3-triethylsilyloxyoct-1-enyl]cyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O[Si](CC)(CC)CC)[C@H]1/C=C/[C@H](CCCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H50O3Si2/c1-9-16-17-18-23(28-30(10-2,11-3)12-4)19-20-24-22(8)25(27)21-26(24)29-31(13-5,14-6)15-7/h19-20,23-24,26H,8-18,21H2,1-7H3/b20-19+/t23-,24-,26+/m0/s1 |
| InChIKey | IYZLVHNXWSPYJG-DIIDMTGESA-N |
| XLogP | 8.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|