C19H31NO5 — CID 88693023
3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid (PubChem CID 88693023) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid.
| Compound Name | 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 88693023 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid |
| SMILES | CCCCCC(O)C=C[C@H]1[C@@H]2C/C(=N\OCCC(=O)O)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C19H31NO5/c1-2-3-4-5-15(21)6-7-16-17-12-14(10-13(17)11-18(16)22)20-25-9-8-19(23)24/h6-7,13,15-18,21-22H,2-5,8-12H2,1H3,(H,23,24)/b7-6?,20-14-/t13-,15?,16-,17+,18-/m0/s1 |
| InChIKey | APTLZCSDEVTJNK-FEXRQHGMSA-N |
| XLogP | 2.74 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|