C20H33NO5 — CID 88693011
4-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxybutanoic acid (PubChem CID 88693011) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxybutanoic acid.
| Compound Name | 4-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 88693011 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 4-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxybutanoic acid |
| SMILES | CCCCCC(O)C=C[C@@H]1[C@@H]2CC(=NOCCCC(=O)O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C20H33NO5/c1-2-3-4-6-16(22)8-9-17-18-13-15(11-14(18)12-19(17)23)21-26-10-5-7-20(24)25/h8-9,14,16-19,22-23H,2-7,10-13H2,1H3,(H,24,25)/t14-,16?,17+,18+,19+/m0/s1 |
| InChIKey | MHSWIZZYBIIMJZ-USFALSSTSA-N |
| XLogP | 3.13 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|