C21H27NO6 — CID 88693529
3-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid (PubChem CID 88693529) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid.
| Compound Name | 3-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 88693529 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-[[(3aR,4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-4-phenoxybut-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoic acid |
| SMILES | O=C(O)CCON=C1C[C@H]2C[C@@H](O)[C@H](C=CC(O)COc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C21H27NO6/c23-16(13-27-17-4-2-1-3-5-17)6-7-18-19-12-15(10-14(19)11-20(18)24)22-28-9-8-21(25)26/h1-7,14,16,18-20,23-24H,8-13H2,(H,25,26)/t14-,16?,18+,19+,20+/m0/s1 |
| InChIKey | MOWVWTKXQRMDAG-WMAFKRDDSA-N |
| XLogP | 2.24 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|