C12H17NO3 — CID 18599122
3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]amino]oxypropanoic acid (PubChem CID 18599122) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]amino]oxypropanoic acid.
| Compound Name | 3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 18599122 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]amino]oxypropanoic acid |
| SMILES | O=C(O)CCO/N=C1/C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C12H17NO3/c14-12(15)5-6-16-13-11-7-9-3-1-2-4-10(9)8-11/h1-2,9-10H,3-8H2,(H,14,15)/b13-11-/t9-,10+/m1/s1 |
| InChIKey | OHGLNHRCWDLAJJ-DREUUTDHSA-N |
| XLogP | 2.21 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|