C10H15NO3 — CID 74968256
3-(2-bicyclo[2.2.1]heptanylideneamino)oxypropanoic acid (PubChem CID 74968256) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylideneamino)oxypropanoic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylideneamino)oxypropanoic acid |
|---|---|
| PubChem CID | 74968256 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylideneamino)oxypropanoic acid |
| SMILES | O=C(O)CCON=C1CC2CCC1C2 |
| InChI | InChI=1S/C10H15NO3/c12-10(13)3-4-14-11-9-6-7-1-2-8(9)5-7/h7-8H,1-6H2,(H,12,13) |
| InChIKey | GROFOJLPSZMPOW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|