C20H31NO5 — CID 88694027
methyl 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate (PubChem CID 88694027) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate.
| Compound Name | methyl 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 88694027 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | methyl 3-[(Z)-[(3aR,4S,5S,6aS)-5-hydroxy-4-(3-oxooct-1-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
| SMILES | CCCCCC(=O)C=C[C@H]1[C@@H]2C/C(=N\OCCC(=O)OC)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C20H31NO5/c1-3-4-5-6-16(22)7-8-17-18-13-15(11-14(18)12-19(17)23)21-26-10-9-20(24)25-2/h7-8,14,17-19,23H,3-6,9-13H2,1-2H3/b8-7?,21-15-/t14-,17-,18+,19-/m0/s1 |
| InChIKey | OIZIQZHNACKEAK-LMEBPZSTSA-N |
| XLogP | 3.03 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|