C20H33NO5 — CID 54398772
3-[[(1S)-3-hydroxy-2-(3-hydroxydec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid (PubChem CID 54398772) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-[[(1S)-3-hydroxy-2-(3-hydroxydec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid.
| Compound Name | 3-[[(1S)-3-hydroxy-2-(3-hydroxydec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 54398772 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 3-[[(1S)-3-hydroxy-2-(3-hydroxydec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid |
| SMILES | CCCCCCCC(O)C=CC1C(O)CC2=C(NOCCC(=O)O)C[C@H]21 |
| InChI | InChI=1S/C20H33NO5/c1-2-3-4-5-6-7-14(22)8-9-15-16-12-18(17(16)13-19(15)23)21-26-11-10-20(24)25/h8-9,14-16,19,21-23H,2-7,10-13H2,1H3,(H,24,25)/t14?,15?,16-,19?/m0/s1 |
| InChIKey | VLXDGWUSIZQNQZ-LDWRGQNGSA-N |
| XLogP | 2.91 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|