C22H37NO5 — CID 54152503
3-[[(1R)-2-hydroxy-3-(3-hydroxydodec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid (PubChem CID 54152503) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 3-[[(1R)-2-hydroxy-3-(3-hydroxydodec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid.
| Compound Name | 3-[[(1R)-2-hydroxy-3-(3-hydroxydodec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 54152503 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 3-[[(1R)-2-hydroxy-3-(3-hydroxydodec-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxypropanoic acid |
| SMILES | CCCCCCCCCC(O)C=CC1CC2=C(NOCCC(=O)O)C[C@H]2C1O |
| InChI | InChI=1S/C22H37NO5/c1-2-3-4-5-6-7-8-9-17(24)11-10-16-14-18-19(22(16)27)15-20(18)23-28-13-12-21(25)26/h10-11,16-17,19,22-24,27H,2-9,12-15H2,1H3,(H,25,26)/t16?,17?,19-,22?/m1/s1 |
| InChIKey | OISDBARCUXXJBI-OZMSUWCKSA-N |
| XLogP | 3.69 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|