C20H35NO5 — CID 56623246
2-[[3-hydroxy-2-(3-hydroxyundecyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid (PubChem CID 56623246) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-[[3-hydroxy-2-(3-hydroxyundecyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid.
| Compound Name | 2-[[3-hydroxy-2-(3-hydroxyundecyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 56623246 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-[[3-hydroxy-2-(3-hydroxyundecyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid |
| SMILES | CCCCCCCCC(O)CCC1C(O)CC2=C(NOCC(=O)O)CC21 |
| InChI | InChI=1S/C20H35NO5/c1-2-3-4-5-6-7-8-14(22)9-10-15-16-11-18(17(16)12-19(15)23)21-26-13-20(24)25/h14-16,19,21-23H,2-13H2,1H3,(H,24,25) |
| InChIKey | GHYDESIMSWXDLN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|