C19H33NO5 — CID 54429680
2-[[2-hydroxy-3-(3-hydroxydecyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid (PubChem CID 54429680) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-(3-hydroxydecyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid.
| Compound Name | 2-[[2-hydroxy-3-(3-hydroxydecyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54429680 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-[[2-hydroxy-3-(3-hydroxydecyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
| SMILES | CCCCCCCC(O)CCC1CC2C(=NOCC(=O)O)CC2C1O |
| InChI | InChI=1S/C19H33NO5/c1-2-3-4-5-6-7-14(21)9-8-13-10-15-16(19(13)24)11-17(15)20-25-12-18(22)23/h13-16,19,21,24H,2-12H2,1H3,(H,22,23) |
| InChIKey | WGPAGQSFFYPWIA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|