C19H31NO5 — CID 54464592
4-[[3-(3-cyclopentyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxybutanoic acid (PubChem CID 54464592) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[[3-(3-cyclopentyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxybutanoic acid.
| Compound Name | 4-[[3-(3-cyclopentyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 54464592 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 4-[[3-(3-cyclopentyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxybutanoic acid |
| SMILES | O=C(O)CCCON=C1CC2C1CC(CCC(O)C1CCCC1)C2O |
| InChI | InChI=1S/C19H31NO5/c21-17(12-4-1-2-5-12)8-7-13-10-14-15(19(13)24)11-16(14)20-25-9-3-6-18(22)23/h12-15,17,19,21,24H,1-11H2,(H,22,23) |
| InChIKey | XDYSSUYROHZRRU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|