C18H29NO5 — CID 54518678
2-[[3-(3-cyclohexyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid (PubChem CID 54518678) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-[[3-(3-cyclohexyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid.
| Compound Name | 2-[[3-(3-cyclohexyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54518678 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-[[3-(3-cyclohexyl-3-hydroxypropyl)-2-hydroxy-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
| SMILES | O=C(O)CON=C1CC2C1CC(CCC(O)C1CCCCC1)C2O |
| InChI | InChI=1S/C18H29NO5/c20-16(11-4-2-1-3-5-11)7-6-12-8-13-14(18(12)23)9-15(13)19-24-10-17(21)22/h11-14,16,18,20,23H,1-10H2,(H,21,22) |
| InChIKey | YOFCJKYCOCOIMH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|