C18H21NO5 — CID 54445393
2-[[(1R,5S)-2-hydroxy-3-(3-hydroxy-3-phenylprop-1-enyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid (PubChem CID 54445393) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[[(1R,5S)-2-hydroxy-3-(3-hydroxy-3-phenylprop-1-enyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid.
| Compound Name | 2-[[(1R,5S)-2-hydroxy-3-(3-hydroxy-3-phenylprop-1-enyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54445393 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[[(1R,5S)-2-hydroxy-3-(3-hydroxy-3-phenylprop-1-enyl)-6-bicyclo[3.2.0]heptanylidene]amino]oxyacetic acid |
| SMILES | O=C(O)CON=C1C[C@H]2C(O)C(C=CC(O)c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C18H21NO5/c20-16(11-4-2-1-3-5-11)7-6-12-8-13-14(18(12)23)9-15(13)19-24-10-17(21)22/h1-7,12-14,16,18,20,23H,8-10H2,(H,21,22)/t12?,13-,14+,16?,18?/m0/s1 |
| InChIKey | WRDDWRGGAZKIDG-HTKPNPNBSA-N |
| XLogP | 1.75 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|