C19H36O6S — CID 70624755
7-[4-hydroxy-3-(3-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid (PubChem CID 70624755) has the molecular formula C19H36O6S and a molecular weight of 392.56 g/mol. Its IUPAC name is 7-[4-hydroxy-3-(3-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid.
| Compound Name | 7-[4-hydroxy-3-(3-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 70624755 |
| Molecular Formula | C19H36O6S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 7-[4-hydroxy-3-(3-hydroxyoctyl)-1,1-dioxothiolan-2-yl]heptanoic acid |
| SMILES | CCCCCC(O)CCC1C(O)CS(=O)(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O6S/c1-2-3-6-9-15(20)12-13-16-17(21)14-26(24,25)18(16)10-7-4-5-8-11-19(22)23/h15-18,20-21H,2-14H2,1H3,(H,22,23) |
| InChIKey | LCTQZAYJRGKMQN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|