C17H25NO5 — CID 54187569
4-[[3-hydroxy-2-(3-hydroxyhex-1-ynyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxybutanoic acid (PubChem CID 54187569) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[[3-hydroxy-2-(3-hydroxyhex-1-ynyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxybutanoic acid.
| Compound Name | 4-[[3-hydroxy-2-(3-hydroxyhex-1-ynyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 54187569 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[[3-hydroxy-2-(3-hydroxyhex-1-ynyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxybutanoic acid |
| SMILES | CCCC(O)C#CC1C(O)CC2=C(NOCCCC(=O)O)CC21 |
| InChI | InChI=1S/C17H25NO5/c1-2-4-11(19)6-7-12-13-9-15(14(13)10-16(12)20)18-23-8-3-5-17(21)22/h11-13,16,18-20H,2-5,8-10H2,1H3,(H,21,22) |
| InChIKey | PGDXDJDIPSAHSG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|