C14H21NO5 — CID 54325836
2-[[(1R)-2-hydroxy-3-(3-hydroxypent-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid (PubChem CID 54325836) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[[(1R)-2-hydroxy-3-(3-hydroxypent-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid.
| Compound Name | 2-[[(1R)-2-hydroxy-3-(3-hydroxypent-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54325836 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[[(1R)-2-hydroxy-3-(3-hydroxypent-1-enyl)-6-bicyclo[3.2.0]hept-5-enyl]amino]oxyacetic acid |
| SMILES | CCC(O)C=CC1CC2=C(NOCC(=O)O)C[C@H]2C1O |
| InChI | InChI=1S/C14H21NO5/c1-2-9(16)4-3-8-5-10-11(14(8)19)6-12(10)15-20-7-13(17)18/h3-4,8-9,11,14-16,19H,2,5-7H2,1H3,(H,17,18)/t8?,9?,11-,14?/m1/s1 |
| InChIKey | SUVVLDWRUYPDDJ-RWUBSZJOSA-N |
| XLogP | 0.57 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|