C26H44N2O8SSi — CID 86665966
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxy-2-[2-(phenylmethoxycarbonylamino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 86665966) has the molecular formula C26H44N2O8SSi and a molecular weight of 572.80 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxy-2-[2-(phenylmethoxycarbonylamino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxy-2-[2-(phenylmethoxycarbonylamino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86665966 |
| Molecular Formula | C26H44N2O8SSi |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-3-methylsulfonyloxy-2-[2-(phenylmethoxycarbonylamino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)C(OS(C)(=O)=O)C1CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H44N2O8SSi/c1-25(2,3)34-24(30)28-17-21(36-38(8,9)26(4,5)6)22(35-37(7,31)32)20(28)15-16-27-23(29)33-18-19-13-11-10-12-14-19/h10-14,20-22H,15-18H2,1-9H3,(H,27,29) |
| InChIKey | IMRVJCRWBGMKOE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|