C22H35NO4Si — CID 139249222
benzyl N-[2-[(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-hydroxycyclohexen-1-yl]ethyl]carbamate (PubChem CID 139249222) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is benzyl N-[2-[(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-hydroxycyclohexen-1-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-hydroxycyclohexen-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 139249222 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | benzyl N-[2-[(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-hydroxycyclohexen-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC=C(CCNC(=O)OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C22H35NO4Si/c1-22(2,3)28(4,5)27-19-13-9-12-18(20(19)24)14-15-23-21(25)26-16-17-10-7-6-8-11-17/h6-8,10-12,19-20,24H,9,13-16H2,1-5H3,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | OFMSNUUZDIXYDD-UXHICEINSA-N |
| XLogP | 4.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|