C24H39NO3Si — CID 11112534
benzyl N-[(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]carbamate (PubChem CID 11112534) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is benzyl N-[(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 11112534 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | benzyl N-[(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]carbamate |
| SMILES | C=CCC[C@H]1CCC[C@@H](NC(=O)OCc2ccccc2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H39NO3Si/c1-7-8-15-20-16-12-17-21(22(20)28-29(5,6)24(2,3)4)25-23(26)27-18-19-13-10-9-11-14-19/h7,9-11,13-14,20-22H,1,8,12,15-18H2,2-6H3,(H,25,26)/t20-,21+,22?/m0/s1 |
| InChIKey | OKNBSMXUWCUALF-UGGDCYSXSA-N |
| XLogP | 6.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|