C23H37NO3Si — CID 91459169
benzyl N-[(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-enylcyclohexyl]carbamate (PubChem CID 91459169) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is benzyl N-[(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-enylcyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-enylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 91459169 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | benzyl N-[(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-enylcyclohexyl]carbamate |
| SMILES | CC=C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-7-11-19-16-20(27-28(5,6)23(2,3)4)14-15-21(19)24-22(25)26-17-18-12-9-8-10-13-18/h7-13,19-21H,14-17H2,1-6H3,(H,24,25)/t19-,20-,21+/m1/s1 |
| InChIKey | GQJDILYJRVVXBS-NJYVYQBISA-N |
| XLogP | 6.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|