C40H57N3O8Si — CID 11814612
tert-butyl 3-[(2S)-2-[3-[(1R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxycarbonylamino)cyclohexyl]propanoylamino]-3-methoxy-3-oxopropyl]indole-1-carboxylate (PubChem CID 11814612) has the molecular formula C40H57N3O8Si and a molecular weight of 736.00 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-2-[3-[(1R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxycarbonylamino)cyclohexyl]propanoylamino]-3-methoxy-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-2-[3-[(1R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxycarbonylamino)cyclohexyl]propanoylamino]-3-methoxy-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11814612 |
| Molecular Formula | C40H57N3O8Si |
| Molecular Weight | 736.00 g/mol |
| Exact Mass | 735.39 |
| IUPAC Name | tert-butyl 3-[(2S)-2-[3-[(1R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxycarbonylamino)cyclohexyl]propanoylamino]-3-methoxy-3-oxopropyl]indole-1-carboxylate |
| SMILES | COC(=O)[C@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC(=O)CC[C@H]1CCC[C@@H](NC(=O)OCc2ccccc2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H57N3O8Si/c1-39(2,3)50-38(47)43-25-29(30-19-13-14-21-33(30)43)24-32(36(45)48-7)41-34(44)23-22-28-18-15-20-31(35(28)51-52(8,9)40(4,5)6)42-37(46)49-26-27-16-11-10-12-17-27/h10-14,16-17,19,21,25,28,31-32,35H,15,18,20,22-24,26H2,1-9H3,(H,41,44)(H,42,46)/t28-,31-,32+,35?/m1/s1 |
| InChIKey | KTYPGLVNWHNJDE-GOCVQRHPSA-N |
| XLogP | 7.89 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.00 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|