C38H44N4O8 — CID 71567175
benzyl (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]-3-[1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]indol-3-yl]propanoate (PubChem CID 71567175) has the molecular formula C38H44N4O8 and a molecular weight of 684.79 g/mol. Its IUPAC name is benzyl (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]-3-[1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]indol-3-yl]propanoate.
| Compound Name | benzyl (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]-3-[1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]indol-3-yl]propanoate |
|---|---|
| PubChem CID | 71567175 |
| Molecular Formula | C38H44N4O8 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | benzyl (2S)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]-3-[1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]indol-3-yl]propanoate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)n1cc(C[C@H](NC(=O)CCCNC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C38H44N4O8/c1-26(40-37(47)49-25-28-16-9-6-10-17-28)34(44)42-23-29(30-18-11-12-19-32(30)42)22-31(35(45)48-24-27-14-7-5-8-15-27)41-33(43)20-13-21-39-36(46)50-38(2,3)4/h5-12,14-19,23,26,31H,13,20-22,24-25H2,1-4H3,(H,39,46)(H,40,47)(H,41,43)/t26-,31-/m0/s1 |
| InChIKey | DLMAYTUGRXSSGE-HVNZXBJASA-N |
| XLogP | 5.67 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|