C28H33N3O7 — CID 59360980
tert-butyl 3-[3-methoxy-3-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propyl]indole-1-carboxylate (PubChem CID 59360980) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is tert-butyl 3-[3-methoxy-3-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[3-methoxy-3-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 59360980 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | tert-butyl 3-[3-methoxy-3-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propyl]indole-1-carboxylate |
| SMILES | COC(=O)C(Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H33N3O7/c1-18(29-26(34)37-17-19-11-7-6-8-12-19)24(32)30-22(25(33)36-5)15-20-16-31(27(35)38-28(2,3)4)23-14-10-9-13-21(20)23/h6-14,16,18,22H,15,17H2,1-5H3,(H,29,34)(H,30,32)/t18-,22?/m0/s1 |
| InChIKey | FQJAMMIUGGELIT-HXBUSHRASA-N |
| XLogP | 3.94 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|