C32H40N2O7 — CID 159256167
tert-butyl 3-[(5R)-2-methoxycarbonyl-7-methyl-4-oxo-5-(phenylmethoxycarbonylamino)octyl]indole-1-carboxylate (PubChem CID 159256167) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is tert-butyl 3-[(5R)-2-methoxycarbonyl-7-methyl-4-oxo-5-(phenylmethoxycarbonylamino)octyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(5R)-2-methoxycarbonyl-7-methyl-4-oxo-5-(phenylmethoxycarbonylamino)octyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 159256167 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | tert-butyl 3-[(5R)-2-methoxycarbonyl-7-methyl-4-oxo-5-(phenylmethoxycarbonylamino)octyl]indole-1-carboxylate |
| SMILES | COC(=O)C(CC(=O)[C@@H](CC(C)C)NC(=O)OCc1ccccc1)Cc1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C32H40N2O7/c1-21(2)16-26(33-30(37)40-20-22-12-8-7-9-13-22)28(35)18-23(29(36)39-6)17-24-19-34(31(38)41-32(3,4)5)27-15-11-10-14-25(24)27/h7-15,19,21,23,26H,16-18,20H2,1-6H3,(H,33,37)/t23?,26-/m1/s1 |
| InChIKey | PJCOCPOWJBSPSG-ANWICMFUSA-N |
| XLogP | 6.06 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|