C16H27NO5S — CID 175444321
benzyl N-(3,3-dimethylpentyl)carbamate;methanesulfonic acid (PubChem CID 175444321) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is benzyl N-(3,3-dimethylpentyl)carbamate;methanesulfonic acid.
| Compound Name | benzyl N-(3,3-dimethylpentyl)carbamate;methanesulfonic acid |
|---|---|
| PubChem CID | 175444321 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | benzyl N-(3,3-dimethylpentyl)carbamate;methanesulfonic acid |
| SMILES | CCC(C)(C)CCNC(=O)OCc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C15H23NO2.CH4O3S/c1-4-15(2,3)10-11-16-14(17)18-12-13-8-6-5-7-9-13;1-5(2,3)4/h5-9H,4,10-12H2,1-3H3,(H,16,17);1H3,(H,2,3,4) |
| InChIKey | MTVZYZWAHFYGDA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|