C24H40N2O3Si — CID 66783504
benzyl N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]carbamate (PubChem CID 66783504) has the molecular formula C24H40N2O3Si and a molecular weight of 432.68 g/mol. Its IUPAC name is benzyl N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 66783504 |
| Molecular Formula | C24H40N2O3Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | benzyl N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(CCCNC(=O)OCc2ccccc2)CCC12CC2 |
| InChI | InChI=1S/C24H40N2O3Si/c1-23(2,3)30(4,5)29-21-18-26(17-14-24(21)12-13-24)16-9-15-25-22(27)28-19-20-10-7-6-8-11-20/h6-8,10-11,21H,9,12-19H2,1-5H3,(H,25,27) |
| InChIKey | BCIVLFNMFGVFJW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|