C24H30N2O4 — CID 22993462
[4-phenyl-1-[3-(phenylmethoxycarbonylamino)propyl]piperidin-4-yl] acetate (PubChem CID 22993462) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [4-phenyl-1-[3-(phenylmethoxycarbonylamino)propyl]piperidin-4-yl] acetate.
| Compound Name | [4-phenyl-1-[3-(phenylmethoxycarbonylamino)propyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 22993462 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [4-phenyl-1-[3-(phenylmethoxycarbonylamino)propyl]piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1(c2ccccc2)CCN(CCCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O4/c1-20(27)30-24(22-11-6-3-7-12-22)13-17-26(18-14-24)16-8-15-25-23(28)29-19-21-9-4-2-5-10-21/h2-7,9-12H,8,13-19H2,1H3,(H,25,28) |
| InChIKey | HHGUUXIZMCLUKF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|